cas: 1159826-16-0 — see every product listed under this CAS number, including other names
Benzyl 3-aminobenzylcarbamate hydrochloride 97% (CAS 1159826-16-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A403305-10g |
| cas | 1159826-16-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 642.94 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 359.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A403305 |
Benzyl N-[(3-aminophenyl)methyl]carbamate;hydrochloride (CAS 1159826-16-0) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 292.76 g/mol. IUPAC name: benzyl N-[(3-aminophenyl)methyl]carbamate;hydrochloride. InChIKey: QJYVWJGMZITUET-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O2 |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | benzyl N-[(3-aminophenyl)methyl]carbamate;hydrochloride |
| InChIKey | QJYVWJGMZITUET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)