CAS 1159826-16-0 appears in our catalog under these names: 3-N-Cbz-aminomethylaniline HC, 97%, Benzyl 3-aminobenzylcarbamate hydrochloride 97%, Benzyl 3-aminobenzylcarbamate hydrochloride, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg.
Benzyl N-[(3-aminophenyl)methyl]carbamate;hydrochloride (CAS 1159826-16-0) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 292.76 g/mol. IUPAC name: benzyl N-[(3-aminophenyl)methyl]carbamate;hydrochloride. InChIKey: QJYVWJGMZITUET-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O2 |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | benzyl N-[(3-aminophenyl)methyl]carbamate;hydrochloride |
| InChIKey | QJYVWJGMZITUET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)