cas: 1159826-16-0 — see every product listed under this CAS number, including other names
Benzyl 3-aminobenzylcarbamate hydrochloride, 97%, 97% (CAS 1159826-16-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EH2G-250mg |
| cas | 1159826-16-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 506.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-[(3-aminophenyl)methyl]carbamate;hydrochloride (CAS 1159826-16-0) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 292.76 g/mol. IUPAC name: benzyl N-[(3-aminophenyl)methyl]carbamate;hydrochloride. InChIKey: QJYVWJGMZITUET-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O2 |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | benzyl N-[(3-aminophenyl)methyl]carbamate;hydrochloride |
| InChIKey | QJYVWJGMZITUET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)