cas: 115909-91-6 — see every product listed under this CAS number, including other names
Benzyl 4-(2-hydroxyethyl)piperidine-1-carboxylate, 98.04% (CAS 115909-91-6) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 500 mg, 100 mg, 1 g, 25 g, 250 mg, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W113678-10 g |
| cas | 115909-91-6 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 1731.47 Pln | |
| MedChemExpress | 500 mg | 431.15 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 621.55 Pln | |
| MedChemExpress | 25 g | 3342.94 Pln | |
| MedChemExpress | 250 mg | 333.62 Pln | |
| MedChemExpress | 5 g | 1127.75 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.04% |
Benzyl 4-(2-hydroxyethyl)piperidine-1-carboxylate (CAS 115909-91-6) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: benzyl 4-(2-hydroxyethyl)piperidine-1-carboxylate. InChIKey: SYXSMTCXQUGEIJ-UHFFFAOYSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | benzyl 4-(2-hydroxyethyl)piperidine-1-carboxylate |
| InChIKey | SYXSMTCXQUGEIJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CCO)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)