CAS 211247-61-9 is the registry number for 1'-(4-Nitrophenyl)-1,4'-bipiperidine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-nitrophenyl)-4-piperidin-1-ylpiperidine (CAS 211247-61-9) is a chemical compound with the molecular formula C16H23N3O2 and a molecular weight of 289.37 g/mol. IUPAC name: 1-(4-nitrophenyl)-4-piperidin-1-ylpiperidine. InChIKey: GFDHQOUUEVQAPD-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O2 |
|---|---|
| Molecular weight | 289.37 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-4-piperidin-1-ylpiperidine |
| InChIKey | GFDHQOUUEVQAPD-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2CCN(CC2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)