Products 230615-61-9
CAS 230615-61-9 is the registry number for 1,1-Dimethylethyldiamino-tetrahydro-methano-3H-3-benzazepine-3-carboxylate. Offered by: TRC. Available pack sizes: 50mg.
Tert-butyl 4,5-diamino-10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene-10-carboxylate (CAS 230615-61-9) is a chemical compound with the molecular formula C16H23N3O2 and a molecular weight of 289.37 g/mol. IUPAC name: tert-butyl 4,5-diamino-10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene-10-carboxylate. InChIKey: FOASJQTWMJUSJT-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O2 |
|---|---|
| Molecular weight | 289.37 g/mol |
| IUPAC name | tert-butyl 4,5-diamino-10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene-10-carboxylate |
| InChIKey | FOASJQTWMJUSJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(C1)C3=CC(=C(C=C23)N)N |
Computed by PubChem (NCBI)