cas: 160809-34-7 — see every product listed under this CAS number, including other names
Benzyl 4-acetylpiperidine-1-carboxylate, 98% (CAS 160809-34-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F680963-250MG |
| cas | 160809-34-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 763.29 Pln | |
| Fluorochem | 5g | 2569.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 4-acetylpiperidine-1-carboxylate (CAS 160809-34-7) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: benzyl 4-acetylpiperidine-1-carboxylate. InChIKey: VOETZCCNDJVWCN-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | benzyl 4-acetylpiperidine-1-carboxylate |
| InChIKey | VOETZCCNDJVWCN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CCN(CC1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)