Benzyl 4-bromobutanoate, 95%, 95%
cas: 126430-46-4 — see every product listed under this CAS number, including other names
Benzyl 4-bromobutanoate, 95%, 95% (CAS 126430-46-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111SSQ-250mg |
| cas | 126430-46-4 |
| size | 250mg |
| availability | 520g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 328.40 Pln | |
| Chemat | 100g | 1125.20 Pln | |
| Chemat | 500g | 3868.80 Pln | |
| Chemat | 50g | 592.40 Pln | |
| Chemat | 250g | 2320.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 4-bromobutanoate (CAS 126430-46-4) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: benzyl 4-bromobutanoate. InChIKey: JJUJDJNFXYNOKI-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | benzyl 4-bromobutanoate |
| InChIKey | JJUJDJNFXYNOKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCBr |
Computed by PubChem (NCBI)
Synonyms:
benzyl 4-bromobutanoate, Butanoic acid, 4-bromo-, phenylmethyl ester, 4-bromo-n-butyric acid benzyl ester, 4-bromobutyric acid benzyl ester, Benzyl 4-bromobutyrate, benzyl-4-bromobutanoate, benzyl-4-bromo-butyrate, Benzyl4-bromobutanoate, benzyl 4-bromo butanoate, JJUJDJNFXYNOKI-UHFFFAOYSA-N