cas: 911298-12-9 — see every product listed under this CAS number, including other names
Benzyl 4-oxo-2-(trifluoromethyl)piperidine-1-carboxylate, 98+% (CAS 911298-12-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A752159-5g |
| cas | 911298-12-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 24612.70 Pln | |
| AmBeed | 10g | 29768.62 Pln | |
| AmBeed | 1g | 7094.29 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl 4-oxo-2-(trifluoromethyl)piperidine-1-carboxylate (CAS 911298-12-9) is a chemical compound with the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. IUPAC name: benzyl 4-oxo-2-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: QIDSGGVIXVGOFX-UHFFFAOYSA-N.
| Molecular formula | C14H14F3NO3 |
|---|---|
| Molecular weight | 301.26 g/mol |
| IUPAC name | benzyl 4-oxo-2-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | QIDSGGVIXVGOFX-UHFFFAOYSA-N |
| SMILES | C1CN(C(CC1=O)C(F)(F)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)