CAS 783366-42-7 is the registry number for Ethyl 3-dimethylamino-2-(2,3,4-trifluorobenzoyl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl (E)-3-(dimethylamino)-2-(2,3,4-trifluorobenzoyl)prop-2-enoate (CAS 783366-42-7) is a chemical compound with the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. IUPAC name: ethyl (E)-3-(dimethylamino)-2-(2,3,4-trifluorobenzoyl)prop-2-enoate. InChIKey: ZSLQSBCBCIQFJL-VQHVLOKHSA-N.
| Molecular formula | C14H14F3NO3 |
|---|---|
| Molecular weight | 301.26 g/mol |
| IUPAC name | ethyl (E)-3-(dimethylamino)-2-(2,3,4-trifluorobenzoyl)prop-2-enoate |
| InChIKey | ZSLQSBCBCIQFJL-VQHVLOKHSA-N |
| SMILES | CCOC(=O)/C(=C/N(C)C)/C(=O)C1=C(C(=C(C=C1)F)F)F |
Computed by PubChem (NCBI)