CAS 1798421-25-6 is the registry number for 4,4,4-Trifluoro-2-(aminomethylphenyl)methylene-3-oxo-butanoic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 500mg, 50mg.
Ethyl (E)-4,4,4-trifluoro-3-hydroxy-2-(4-methylbenzenecarboximidoyl)but-2-enoate (CAS 1798421-25-6) is a chemical compound with the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. IUPAC name: ethyl (E)-4,4,4-trifluoro-3-hydroxy-2-(4-methylbenzenecarboximidoyl)but-2-enoate. InChIKey: SYNJEIJEACTAKR-ULPVHAHSSA-N.
| Molecular formula | C14H14F3NO3 |
|---|---|
| Molecular weight | 301.26 g/mol |
| IUPAC name | ethyl (E)-4,4,4-trifluoro-3-hydroxy-2-(4-methylbenzenecarboximidoyl)but-2-enoate |
| InChIKey | SYNJEIJEACTAKR-ULPVHAHSSA-N |
| SMILES | CCOC(=O)/C(=C(\C(F)(F)F)/O)/C(=N)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)