cas: 935687-49-3 — see every product listed under this CAS number, including other names
Benzyl 6-aminonicotinate 96% (CAS 935687-49-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A514137-250mg |
| cas | 935687-49-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 932.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A514137 |
Benzyl 6-aminopyridine-3-carboxylate (CAS 935687-49-3) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: benzyl 6-aminopyridine-3-carboxylate. InChIKey: WZFRFMFRNZBTPU-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | benzyl 6-aminopyridine-3-carboxylate |
| InChIKey | WZFRFMFRNZBTPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)