CAS 116702-63-7 appears in our catalog under these names: 3-Amino-2-(phenylamino)benzoic acid, 95%, 3–Amino–2–(phenylamino)benzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-amino-2-anilinobenzoic acid (CAS 116702-63-7) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 3-amino-2-anilinobenzoic acid. InChIKey: BIBXBQMYVSAURA-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 3-amino-2-anilinobenzoic acid |
| InChIKey | BIBXBQMYVSAURA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC=C2N)C(=O)O |
Computed by PubChem (NCBI)