cas: 1203260-55-2 — see every product listed under this CAS number, including other names
Benzyl piperidin-3-ylcarbamate hydrochloride, 97% (CAS 1203260-55-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A604831-1g |
| cas | 1203260-55-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 1274.35 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 362.39 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 381.20 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl N-piperidin-3-ylcarbamate;hydrochloride (CAS 1203260-55-2) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl N-piperidin-3-ylcarbamate;hydrochloride. InChIKey: RAIJBIOKQJMHNV-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl N-piperidin-3-ylcarbamate;hydrochloride |
| InChIKey | RAIJBIOKQJMHNV-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)NC(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)