cas: 32064-65-6 — see every product listed under this CAS number, including other names
Benzylhydrazine oxalate, ≥96%, ≥96% (CAS 32064-65-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114O5Z-1g |
| cas | 32064-65-6 |
| size | 1g |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 770.00 Pln |
| purity | ≥96% |
|---|---|
| delivery time | 3 weeks |
Benzylhydrazine;oxalic acid (CAS 32064-65-6) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: benzylhydrazine;oxalic acid. InChIKey: RCHUSXHCJLZTEY-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | benzylhydrazine;oxalic acid |
| InChIKey | RCHUSXHCJLZTEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)