cas: 1719-83-1 — see every product listed under this CAS number, including other names
Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic dianhydride 98% (CAS 1719-83-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A937143-5g |
| cas | 1719-83-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 893.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A937143 |
4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (CAS 1719-83-1) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone. InChIKey: XLOGCGOPKPCECW-UHFFFAOYSA-N.
| Molecular formula | C12H8O6 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| InChIKey | XLOGCGOPKPCECW-UHFFFAOYSA-N |
| SMILES | C1=CC2C3C(C1C4C2C(=O)OC4=O)C(=O)OC3=O |
Computed by PubChem (NCBI)