cas: 1719-83-1 — see every product listed under this CAS number, including other names
4,4a,8,8a-Tetrahydro-4,8-ethenobenzo[1,2-c:4,5-c']difuran-1,3,5,7(3aH,7aH)-tetraone, 98% (CAS 1719-83-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319702-5G |
| cas | 1719-83-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 50g | 388.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (CAS 1719-83-1) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone. InChIKey: XLOGCGOPKPCECW-UHFFFAOYSA-N.
| Molecular formula | C12H8O6 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| InChIKey | XLOGCGOPKPCECW-UHFFFAOYSA-N |
| SMILES | C1=CC2C3C(C1C4C2C(=O)OC4=O)C(=O)OC3=O |
Computed by PubChem (NCBI)