cas: 1719-83-1 — see every product listed under this CAS number, including other names
Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic Dianhydride, >98.0%(T) (CAS 1719-83-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1317-25G |
| cas | 1719-83-1 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 192.10 Pln | |
| TCI | 500g | 1627.94 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (CAS 1719-83-1) is a chemical compound with the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. IUPAC name: 4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone. InChIKey: XLOGCGOPKPCECW-UHFFFAOYSA-N.
| Molecular formula | C12H8O6 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| InChIKey | XLOGCGOPKPCECW-UHFFFAOYSA-N |
| SMILES | C1=CC2C3C(C1C4C2C(=O)OC4=O)C(=O)OC3=O |
Computed by PubChem (NCBI)