Biotin-DADOO 98%
cas: 138529-46-1 — see every product listed under this CAS number, including other names
Biotin-DADOO 98% (CAS 138529-46-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A161581-50mg |
| cas | 138529-46-1 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 453.81 Pln | |
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 993.38 Pln | |
| Ambeed | 1g | 2378.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A161581 |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pentanamide (CAS 138529-46-1) is a chemical compound with the molecular formula C16H30N4O4S and a molecular weight of 374.5 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pentanamide. InChIKey: LWISPDYGRSGXME-YDHLFZDLSA-N.
| Molecular formula | C16H30N4O4S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pentanamide |
| InChIKey | LWISPDYGRSGXME-YDHLFZDLSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCN)NC(=O)N2 |
Computed by PubChem (NCBI)