cas: 138529-46-1 — see every product listed under this CAS number, including other names
Biotin-PEG2-Amine, >95.0%(HPLC) (CAS 138529-46-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3171-25MG |
| cas | 138529-46-1 |
| size | 25mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25mg | 364.21 Pln | |
| TCI | 100mg | 1037.87 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC) |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pentanamide (CAS 138529-46-1) is a chemical compound with the molecular formula C16H30N4O4S and a molecular weight of 374.5 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pentanamide. InChIKey: LWISPDYGRSGXME-YDHLFZDLSA-N.
| Molecular formula | C16H30N4O4S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pentanamide |
| InChIKey | LWISPDYGRSGXME-YDHLFZDLSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCN)NC(=O)N2 |
Computed by PubChem (NCBI)