cas: 138529-46-1 — see every product listed under this CAS number, including other names
N-(2-(2-(2-Aminoethoxy)ethoxy)ethyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide, 97%, 97% (CAS 138529-46-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1120EB-10mg |
| cas | 138529-46-1 |
| size | 10mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 285.20 Pln | |
| Chemat | 25mg | 290.00 Pln | |
| Chemat | 50mg | 453.20 Pln | |
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 981.20 Pln | |
| Chemat | 1g | 2416.40 Pln | |
| Chemat | 5g | 9923.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pentanamide (CAS 138529-46-1) is a chemical compound with the molecular formula C16H30N4O4S and a molecular weight of 374.5 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pentanamide. InChIKey: LWISPDYGRSGXME-YDHLFZDLSA-N.
| Molecular formula | C16H30N4O4S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]pentanamide |
| InChIKey | LWISPDYGRSGXME-YDHLFZDLSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCN)NC(=O)N2 |
Computed by PubChem (NCBI)