cas: 6422-86-2 — see every product listed under this CAS number, including other names
Bis(2-ethylhexyl) terephthalate, 97% (CAS 6422-86-2) is a chemical reagent available from Chemat. Available pack sizes: 1KG, 10KG, 250g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 402490010 |
| cas | 6422-86-2 |
| size | 1KG |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1KG | 250.79 Pln | |
| Thermo Scientific (Acros) | 10KG | 864.16 Pln | |
| Thermo Scientific (Acros) | 250g | 95.33 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Bis(2-ethylhexyl) benzene-1,4-dicarboxylate (CAS 6422-86-2) is a chemical compound with the molecular formula C24H38O4 and a molecular weight of 390.6 g/mol. IUPAC name: bis(2-ethylhexyl) benzene-1,4-dicarboxylate. InChIKey: RWPICVVBGZBXNA-UHFFFAOYSA-N.
| Molecular formula | C24H38O4 |
|---|---|
| Molecular weight | 390.6 g/mol |
| IUPAC name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| InChIKey | RWPICVVBGZBXNA-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC |
Computed by PubChem (NCBI)