CAS 6422-86-2 appears in our catalog under these names: BIS(2-ETHYLHEXYL) TEREPHTHALATE, Bis(2-ethylhexyl) terephthalate, 97%, Bis(2-ethylhexyl) terephthalate (Standard), Bis(2-ethylhexyl) terephthalate 98%, Bis(2-ethylhexyl) terephthalate, 98%. Offered by: Sigma-Aldrich, Thermo Scientific (Acros), MedChemExpress, Ambeed, Dr. Ehrenstorfer. Available pack sizes: 1ML, 1KG, 10KG, 250g, 100 mg, 250 mg, 500 mg, 50 mg.
Bis(2-ethylhexyl) benzene-1,4-dicarboxylate (CAS 6422-86-2) is a chemical compound with the molecular formula C24H38O4 and a molecular weight of 390.6 g/mol. IUPAC name: bis(2-ethylhexyl) benzene-1,4-dicarboxylate. InChIKey: RWPICVVBGZBXNA-UHFFFAOYSA-N.
| Molecular formula | C24H38O4 |
|---|---|
| Molecular weight | 390.6 g/mol |
| IUPAC name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| InChIKey | RWPICVVBGZBXNA-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC |
Computed by PubChem (NCBI)