Bis(6-methylheptyl) phthalate, 95%
cas: 131-20-4 — see every product listed under this CAS number, including other names
Bis(6-methylheptyl) phthalate, 95% (CAS 131-20-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 100g, 5g, 25g. Offered by: AmBeed, Chemat, BLDpharm.
| brand | AmBeed |
|---|---|
| catalog number | A168442-10g |
| cas | 131-20-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 219.73 Pln | |
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 576.19 Pln | |
| Ambeed | 1g | 1438.38 Pln | |
| Ambeed | 100g | 53648.00 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 1g | 1686.80 Pln | |
| Chemat | 5g | 5742.80 Pln | |
| Chemat | 10g | 9150.80 Pln | |
| BLDpharm | 100mg | 375.45 Pln | |
| BLDpharm | 250mg | 619.81 Pln | |
| BLDpharm | 1g | 1547.26 Pln | |
| BLDpharm | 5g | 5229.29 Pln | |
| BLDpharm | 25g | 18124.75 Pln | |
| BLDpharm | 100g | 57838.55 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Diisooctyl phthalate is a phthalate ester and a diester.
Source: ChEBI
| Molecular formula | C24H38O4 |
|---|---|
| Molecular weight | 390.6 g/mol |
| IUPAC name | bis(6-methylheptyl) benzene-1,2-dicarboxylate |
| InChIKey | IJFPVINAQGWBRJ-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCC(C)C |
Computed by PubChem (NCBI)