Products 2209087-06-7
CAS 2209087-06-7 appears in our catalog under these names: Bis(6-methylheptyl) Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Bis(6-methylheptyl) Phthalate-3,4,5,6-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
Bis(6-methylheptyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 2209087-06-7) is a chemical compound with the molecular formula C24H38O4 and a molecular weight of 394.6 g/mol. IUPAC name: bis(6-methylheptyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: IJFPVINAQGWBRJ-MIQLSMKXSA-N.
| Molecular formula | C24H38O4 |
|---|---|
| Molecular weight | 394.6 g/mol |
| IUPAC name | bis(6-methylheptyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | IJFPVINAQGWBRJ-MIQLSMKXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCCC(C)C)C(=O)OCCCCCC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)