Bis-PEG9-acid 97%
cas: 1268488-70-5 — see every product listed under this CAS number, including other names
Bis-PEG9-acid 97% (CAS 1268488-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A729927-100mg |
| cas | 1268488-70-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 982.25 Pln | |
| Ambeed | 5g | 4620.12 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A729927 |
3-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1268488-70-5) is a chemical compound with the molecular formula C22H42O13 and a molecular weight of 514.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: MZPXCHJGEDEJHQ-UHFFFAOYSA-N.
| Molecular formula | C22H42O13 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | MZPXCHJGEDEJHQ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)