CAS 22567-38-0 appears in our catalog under these names: Bisabolone oxide A/ 98%, Bisabolone oxide A. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg.
(6S)-2,2,6-trimethyl-6-[(1S)-4-methylcyclohex-3-en-1-yl]oxan-3-one (CAS 22567-38-0) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: (6S)-2,2,6-trimethyl-6-[(1S)-4-methylcyclohex-3-en-1-yl]oxan-3-one. InChIKey: MJWZYBQLHJQQJJ-DOMZBBRYSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | (6S)-2,2,6-trimethyl-6-[(1S)-4-methylcyclohex-3-en-1-yl]oxan-3-one |
| InChIKey | MJWZYBQLHJQQJJ-DOMZBBRYSA-N |
| SMILES | CC1=CC[C@H](CC1)[C@@]2(CCC(=O)C(O2)(C)C)C |
Computed by PubChem (NCBI)