cas: 849762-24-9 — see every product listed under this CAS number, including other names
Blattellaquinone 95% (CAS 849762-24-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129628-100mg |
| cas | 849762-24-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 403.75 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1544.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A129628 |
(3,6-dioxocyclohexa-1,4-dien-1-yl)methyl 3-methylbutanoate (CAS 849762-24-9) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (3,6-dioxocyclohexa-1,4-dien-1-yl)methyl 3-methylbutanoate. InChIKey: JVMUMZYOAWLJQW-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (3,6-dioxocyclohexa-1,4-dien-1-yl)methyl 3-methylbutanoate |
| InChIKey | JVMUMZYOAWLJQW-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)OCC1=CC(=O)C=CC1=O |
Computed by PubChem (NCBI)