cas: 779335-06-7 — see every product listed under this CAS number, including other names
Boc-3-amino-5-(Fmoc-amino)benzoic acid 98% (CAS 779335-06-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A166850-100mg |
| cas | 779335-06-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 348.12 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1199.19 Pln | |
| Ambeed | 5g | 4408.75 Pln | |
| Ambeed | 10g | 7991.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A166850 |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 779335-06-7) is a chemical compound with the molecular formula C27H26N2O6 and a molecular weight of 474.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: KNYZSHDTFJANSS-UHFFFAOYSA-N.
| Molecular formula | C27H26N2O6 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | KNYZSHDTFJANSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)