CAS 1823479-63-5 is the registry number for Fmoc-Dbz(o-Boc)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 1823479-63-5) is a chemical compound with the molecular formula C27H26N2O6 and a molecular weight of 474.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: OTQYPLBJEKXEKZ-UHFFFAOYSA-N.
| Molecular formula | C27H26N2O6 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | OTQYPLBJEKXEKZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)