cas: 84348-38-9 — see every product listed under this CAS number, including other names
Boc-4-Methylene-Pro-OH 97% (CAS 84348-38-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158563-250mg |
| cas | 84348-38-9 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 320.31 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1633.06 Pln | |
| Ambeed | 500g | 6311.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A158563 |
(2S)-4-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 84348-38-9) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: (2S)-4-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: ULLGRIBXGPATMA-QMMMGPOBSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (2S)-4-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ULLGRIBXGPATMA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=C)C[C@H]1C(=O)O |
Computed by PubChem (NCBI)