cas: 37535-57-2 — see every product listed under this CAS number, including other names
Boc-Ala(4-pyridyl)-OH, 98%, 98% (CAS 37535-57-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OH9-250mg |
| cas | 37535-57-2 |
| size | 250mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 500mg | 136.40 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 990.80 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 100g | 8320.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-4-ylpropanoic acid (CAS 37535-57-2) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-4-ylpropanoic acid. InChIKey: FNYWDMKESUACOU-JTQLQIEISA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-4-ylpropanoic acid |
| InChIKey | FNYWDMKESUACOU-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=NC=C1)C(=O)O |
Computed by PubChem (NCBI)