CAS 37535-57-2 appears in our catalog under these names: Boc–Ala(4–pyridyl)–OH, Boc-L-4Pal-OH, Boc-Ala(4-pyridyl)-OH, 98%, 98%, Boc-Ala(4-pyridyl)-OH, 98.0%, Boc-Ala(4-pyridyl)-OH, 95%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 500mg, 10g, 100g, 5 g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-4-ylpropanoic acid (CAS 37535-57-2) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-4-ylpropanoic acid. InChIKey: FNYWDMKESUACOU-JTQLQIEISA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-4-ylpropanoic acid |
| InChIKey | FNYWDMKESUACOU-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=NC=C1)C(=O)O |
Computed by PubChem (NCBI)