cas: 501015-16-3 — see every product listed under this CAS number, including other names
Boc-D-β-Phe(3-Br)-OH 98% (CAS 501015-16-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A822510-100mg |
| cas | 501015-16-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A822510 |
(3R)-3-(3-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 501015-16-3) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: (3R)-3-(3-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UTYRIGRZLZNTLR-LLVKDONJSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | (3R)-3-(3-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UTYRIGRZLZNTLR-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)