CAS 501015-16-3 appears in our catalog under these names: (R)–3–(3–Bromophenyl)–3–((tert–butoxycarbonyl)amino)propanoic acid, (R)-3-(3-Bromophenyl)-3-((tert-butoxycarbonyl)amino)propanoic acid, 98%, 98%, (R)-N-Boc-3-bromo-beta-phenylalanine, 95%, Boc-D-β-Phe(3-Br)-OH 98%. Offered by: GLPBio, Chemat, Combi-blocks, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5g.
(3R)-3-(3-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 501015-16-3) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: (3R)-3-(3-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UTYRIGRZLZNTLR-LLVKDONJSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | (3R)-3-(3-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UTYRIGRZLZNTLR-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)