CAS 132153-48-1 appears in our catalog under these names: 3-(4-Bromophenyl)-2-(BOC-amino)propanoic acid, 98%, Boc-DL-Phe(4-Br)-OH, 95%, 4-Bromo-N-Boc-DL-phenylalanine, 4-Bromo-N-[(1,1-dimethylethoxy)carbonyl]phenylalanine, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 5g, 10g, 1g, 2,5g.
3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 132153-48-1) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: 3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ULNOXUAEIPUJMK-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | 3-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ULNOXUAEIPUJMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)