Boc-D-Dap(Fmoc)-OH, 97%
cas: 131570-56-4 — see every product listed under this CAS number, including other names
Boc-D-Dap(Fmoc)-OH, 97% (CAS 131570-56-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A213591-250mg |
| cas | 131570-56-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 25g | 759.75 Pln | |
| Ambeed | 100g | 2689.94 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 225.50 Pln | |
| BLDpharm | 25g | 814.18 Pln | |
| BLDpharm | 100g | 2896.78 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 131570-56-4) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: (2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MVWPBNQGEGBGRF-LJQANCHMSA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MVWPBNQGEGBGRF-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)
