CAS 122235-70-5 appears in our catalog under these names: Boc–Dap(Fmoc)–OH, Boc-L-Dap(Fmoc)-OH, (S)-2-(Boc-amino)-3-(Fmoc-amino)propionic acid, 98% , Boc-Dap(Fmoc)-OH 95%, Boc-Dap(Fmoc)-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 10g, 50g, 250g.
(2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 122235-70-5) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MVWPBNQGEGBGRF-IBGZPJMESA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MVWPBNQGEGBGRF-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)