Products 2580941-14-4
CAS 2580941-14-4 appears in our catalog under these names: Estrogen receptor β antagonist 2, Estrogen receptor β antagonist 2, Estrogen receptor β antagonist 2, 98.39%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50 mg, 25 mg, 5 mg, 10 mg.
Methyl 2-amino-7-hydroxy-4-[4-(2-morpholin-4-ylethoxy)phenyl]-4H-chromene-3-carboxylate (CAS 2580941-14-4) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: methyl 2-amino-7-hydroxy-4-[4-(2-morpholin-4-ylethoxy)phenyl]-4H-chromene-3-carboxylate. InChIKey: LGKRRXWJWOLXAM-UHFFFAOYSA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | methyl 2-amino-7-hydroxy-4-[4-(2-morpholin-4-ylethoxy)phenyl]-4H-chromene-3-carboxylate |
| InChIKey | LGKRRXWJWOLXAM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(OC2=C(C1C3=CC=C(C=C3)OCCN4CCOCC4)C=CC(=C2)O)N |
Computed by PubChem (NCBI)