Boc-D-Pyroglutaminol, 97%
cas: 128811-37-0 — see every product listed under this CAS number, including other names
Boc-D-Pyroglutaminol, 97% (CAS 128811-37-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A188776-250mg |
| cas | 128811-37-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 598.44 Pln | |
| Ambeed | 10g | 1121.31 Pln | |
| Ambeed | 25g | 2662.12 Pln | |
| Ambeed | 100g | 8369.25 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 642.02 Pln | |
| BLDpharm | 10g | 1202.93 Pln | |
| BLDpharm | 25g | 2863.46 Pln | |
| BLDpharm | 100g | 9016.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (2R)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate (CAS 128811-37-0) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: tert-butyl (2R)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate. InChIKey: NYYVBJAPYGKIEN-SSDOTTSWSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | tert-butyl (2R)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate |
| InChIKey | NYYVBJAPYGKIEN-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)CO |
Computed by PubChem (NCBI)