Products 128811-37-0
CAS 128811-37-0 appears in our catalog under these names: Boc–D–Pyroglutaminol, Boc-D-Pyroglutaminol 97%, Boc-D-Pyroglutaminol, 97%, 97%, Boc-D-Pyroglutaminol, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 250mg, 10g.
Tert-butyl (2R)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate (CAS 128811-37-0) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: tert-butyl (2R)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate. InChIKey: NYYVBJAPYGKIEN-SSDOTTSWSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | tert-butyl (2R)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate |
| InChIKey | NYYVBJAPYGKIEN-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)CO |
Computed by PubChem (NCBI)