Products 81658-25-5
CAS 81658-25-5 appears in our catalog under these names: Boc-L-Pyroglutaminol 95%, Boc-L-Pyroglutaminol, 95%, 95%, Boc-L-Pyroglutaminol, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 50g, 100g, 100mg, 10g.
Tert-butyl (2S)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate (CAS 81658-25-5) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: tert-butyl (2S)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate. InChIKey: NYYVBJAPYGKIEN-ZETCQYMHSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | tert-butyl (2S)-2-(hydroxymethyl)-5-oxopyrrolidine-1-carboxylate |
| InChIKey | NYYVBJAPYGKIEN-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CCC1=O)CO |
Computed by PubChem (NCBI)