cas: 248921-66-6 — see every product listed under this CAS number, including other names
Boc-D-Ser(tBu)-OH, 95%, 95% (CAS 248921-66-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PRB-1g |
| cas | 248921-66-6 |
| size | 1g |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 15g | 242.00 Pln | |
| Chemat | 25g | 275.60 Pln | |
| Chemat | 50g | 477.20 Pln | |
| Chemat | 100g | 870.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 248921-66-6) is a chemical compound with the molecular formula C12H23NO5 and a molecular weight of 261.31 g/mol. IUPAC name: (2R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: BPYLRGKEIUPMRJ-MRVPVSSYSA-N.
| Molecular formula | C12H23NO5 |
|---|---|
| Molecular weight | 261.31 g/mol |
| IUPAC name | (2R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | BPYLRGKEIUPMRJ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)