Boc-D-homoserine, 98%, 98%
cas: 745011-75-0 — see every product listed under this CAS number, including other names
Boc-D-homoserine, 98%, 98% (CAS 745011-75-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11401T-250mg |
| cas | 745011-75-0 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 10g | 366.80 Pln | |
| Chemat | 25g | 784.40 Pln | |
| Chemat | 50g | 1442.00 Pln | |
| Chemat | 100g | 2738.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 745011-75-0) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PZEMWPDUXBZKJN-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PZEMWPDUXBZKJN-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCO)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Boc-D-Homoserine, Boc-D-HoSer-OH, (tert-butoxycarbonyl)-D-homoserine, (2R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid, N-(tert-Butoxycarbonyl)-D-homoserine, (2R)-2-(tert-butoxycarbonylamino)-4-hydroxy-butanoic acid, (R)-2-(Tert-butoxycarbonylamino)-4-hydroxybutanoic acid, (2R)-2-{[(tert-butoxy)carbonyl]amino}-4-hydroxybutanoic acid, D-Homoserine, N-[(1,1-dimethylethoxy)carbonyl]-, N-Boc-D-homoserine