Boc-Dap(Fmoc)-OH, 95%
cas: 122235-70-5 — see every product listed under this CAS number, including other names
Boc-Dap(Fmoc)-OH, 95% (CAS 122235-70-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A141078-250mg |
| cas | 122235-70-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 214.62 Pln | |
| Ambeed | 25g | 403.75 Pln | |
| Ambeed | 100g | 1104.63 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 225.50 Pln | |
| BLDpharm | 25g | 430.98 Pln | |
| BLDpharm | 100g | 1186.27 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 122235-70-5) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MVWPBNQGEGBGRF-IBGZPJMESA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MVWPBNQGEGBGRF-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)
