CAS 55260-24-7 appears in our catalog under these names: Boc–Gln(Xan)–OH, Boc-L-Gln(Xan)-OH, Boc-Gln(Xan)-OH, 97%, 97%, Boc-Gln(Xan)-OH, 99.69%, boc-gln(xan)-oh, 97%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 5 g, 10 g, 1 g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid (CAS 55260-24-7) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid. InChIKey: HOIIDGIJEPOSLL-INIZCTEOSA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid |
| InChIKey | HOIIDGIJEPOSLL-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)NC1C2=CC=CC=C2OC3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)