cas: 51871-42-2 — see every product listed under this CAS number, including other names
Boc-Gly-Leu-OH, 95%, 95% (CAS 51871-42-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCGF-250mg |
| cas | 51871-42-2 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 25g | 630.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]pentanoic acid (CAS 51871-42-2) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: (2S)-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]pentanoic acid. InChIKey: RGNNFKYULPHSJI-VIFPVBQESA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (2S)-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]pentanoic acid |
| InChIKey | RGNNFKYULPHSJI-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)