cas: 51871-42-2 — see every product listed under this CAS number, including other names
Boc-Gly-Leu-OH, 98.0% (CAS 51871-42-2) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 10 g, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W101497-25 g |
| cas | 51871-42-2 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 969.85 Pln | |
| MedChemExpress | 10 g | 547.25 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 5 g | 384.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(2S)-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]pentanoic acid (CAS 51871-42-2) is a chemical compound with the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. IUPAC name: (2S)-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]pentanoic acid. InChIKey: RGNNFKYULPHSJI-VIFPVBQESA-N.
| Molecular formula | C13H24N2O5 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (2S)-4-methyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]pentanoic acid |
| InChIKey | RGNNFKYULPHSJI-VIFPVBQESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)