Boc-L-Homoserine, 98%, 98%
cas: 41088-86-2 — see every product listed under this CAS number, including other names
Boc-L-Homoserine, 98%, 98% (CAS 41088-86-2) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 10kg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXRA-1kg |
| cas | 41088-86-2 |
| size | 1kg |
| availability | 10000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 4456.40 Pln | |
| Chemat | 5kg | 21508.80 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 50g | 491.60 Pln | |
| Chemat | 100g | 856.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 41088-86-2) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PZEMWPDUXBZKJN-LURJTMIESA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PZEMWPDUXBZKJN-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCO)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2S)-2-{[(tert-butoxy)carbonyl]amino}-4-hydroxybutanoic acid, N-[(1,1-dimethylethoxy)carbonyl]-L-Homoserine, N-((1,1-Dimethylethoxy)carbonyl)-L-homoserine, (2S)-2-(((tert-butoxy)carbonyl)amino)-4-hydroxybutanoic acid, Boc-L-homoserine, N-Boc-L-Homoserine, Boc-Homoserine, n-t-boc-l-homoserine, n-(tert-butoxycarbonyl)-l-homoserine, Boc-Hse-OH