cas: 132622-65-2 — see every product listed under this CAS number, including other names
Boc-L-Pro(4-N3)-OH (2S,4S) (CAS 132622-65-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 500mg. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | BAA1905.0001 |
| cas | 132622-65-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 1g | 812.24 Pln | |
| Iris Biotech | 5g | 2618.00 Pln | |
| Iris Biotech | 25g | 10142.00 Pln | |
| Iris Biotech | 500mg | 561.44 Pln |
| purity | No data |
|---|---|
| delivery time | 2 weeks |
(2S,4S)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 132622-65-2) is a chemical compound with the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. IUPAC name: (2S,4S)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JZEOWBJXFSZTJU-BQBZGAKWSA-N.
| Molecular formula | C10H16N4O4 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | (2S,4S)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JZEOWBJXFSZTJU-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)